saliimahassan saliimahassan
  • 03-07-2020
  • Biology
contestada

Give the word and chemical equations for respiration and photosynthesis

Respuesta :

Аноним Аноним
  • 03-07-2020

Answer:

PHOTOSYNTHESIS

carbon dioxide(CO2)+water(H2O)+sun light in the presence of chlorophyll(C55H72O5N4Mg)⇒glucose(C6H12O6)+oxygen(O2)+ATP(energy)

RESPIRATION

Glucose(C6H12O6)+Oxygen(O2)⇒carbon dioxide(CO2)+water(H2O)+oxtgen(O2)

Explanation:

I HOPE THIS WILL HELP YOU :)

Answer Link

Otras preguntas

SAT Help Jack can paint a house in 5 days, and Richard can paint the same house in 7 days. Working together, how long will it take them to finish the job? How d
y varies directly as x. if x=5 when y=12 find x when y=30
What is 38/50 as a decimal... and what is 28/50 as a decimal? PLEASE HELP ME !!!! i hate struggling with homework!
Explain why the railroads were not built in a straight line from east to west.
What does imagery mean
Predict what happens when zinc is added to water
how does.debate in the senate differ from debate in the house?
the length of a rectangle is 3 feet less than twice the width of the rectangle. if the perimeter of the rectangle is 324 feet, find the width and the length?
Type of picture Paul Revere made of the Boston massacre?
SAT Help Jack can paint a house in 5 days, and Richard can paint the same house in 7 days. Working together, how long will it take them to finish the job? How d