weezer010902 weezer010902
  • 03-11-2019
  • Chemistry
contestada

How many moles of oxygen are required to produce 4 moles of water?​

How many moles of oxygen are required to produce 4 moles of water class=

Respuesta :

maizetycorn
maizetycorn maizetycorn
  • 03-11-2019

Answer:

6 moles of oxygen

Explanation:We can find from the chemistry equation

C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)

6 moles O2 ~4 moles  H2O

Answer Link
soniaaguirre01234
soniaaguirre01234 soniaaguirre01234
  • 03-11-2019
6. How do I know? Just took the test boyy
Answer Link

Otras preguntas

What organelles could you find in lettuce cells but not mouse cells?
what is 8.4 divided by 7
What organelles could you find in lettuce cells but not mouse cells?
Who is Governer of FL?
Identify the type of chemical reaction. H2CO3 H2O + CO2 decomposition exchange reversible synthesis
a number greater than 18.55 and less than 18.6
gavin has 460 baseball players in his collection of baseball cards and 15% of the players are pitchers.how many pitchers are in gavins collection
What are particles of carbon otherwise known as, and what kind of pollution do they cause???
A mutation changes the DNA sequence AAGCCTGGCAAT to the new sequence AAGCCTGCGCAAT. What kind of mutation has occurred? A. deletion B. insertion C. duplication
Square root of 8464 eliminating possibilities